C11H16N4 — CID 139724628
1-(2,3-dihydro-1H-indol-5-yl)-1,2-dimethylguanidine (PubChem CID 139724628) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-indol-5-yl)-1,2-dimethylguanidine.
| Compound Name | 1-(2,3-dihydro-1H-indol-5-yl)-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 139724628 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 1-(2,3-dihydro-1H-indol-5-yl)-1,2-dimethylguanidine |
| SMILES | C/N=C(\N)N(C)c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C11H16N4/c1-13-11(12)15(2)9-3-4-10-8(7-9)5-6-14-10/h3-4,7,14H,5-6H2,1-2H3,(H2,12,13) |
| InChIKey | WVUZLMQMMKONFF-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|