C10H8F5N — CID 84699877
5-(1,1,2,2,2-pentafluoroethyl)-2,3-dihydro-1H-indole (PubChem CID 84699877) has the molecular formula C10H8F5N and a molecular weight of 237.17 g/mol. Its IUPAC name is 5-(1,1,2,2,2-pentafluoroethyl)-2,3-dihydro-1H-indole.
| Compound Name | 5-(1,1,2,2,2-pentafluoroethyl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 84699877 |
| Molecular Formula | C10H8F5N |
| Molecular Weight | 237.17 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 5-(1,1,2,2,2-pentafluoroethyl)-2,3-dihydro-1H-indole |
| SMILES | FC(F)(F)C(F)(F)c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C10H8F5N/c11-9(12,10(13,14)15)7-1-2-8-6(5-7)3-4-16-8/h1-2,5,16H,3-4H2 |
| InChIKey | LESIMYUDFXFYMO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.17 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|