C22H23FN2O5 — CID 71154840
(2R)-2-[[(E)-3-[4-(2,3-dihydro-1H-indol-5-yl)-2,5-dimethoxyphenyl]-2-fluoroprop-2-enoyl]amino]propanoic acid (PubChem CID 71154840) has the molecular formula C22H23FN2O5 and a molecular weight of 414.43 g/mol. Its IUPAC name is (2R)-2-[[(E)-3-[4-(2,3-dihydro-1H-indol-5-yl)-2,5-dimethoxyphenyl]-2-fluoroprop-2-enoyl]amino]propanoic acid.
| Compound Name | (2R)-2-[[(E)-3-[4-(2,3-dihydro-1H-indol-5-yl)-2,5-dimethoxyphenyl]-2-fluoroprop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 71154840 |
| Molecular Formula | C22H23FN2O5 |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | (2R)-2-[[(E)-3-[4-(2,3-dihydro-1H-indol-5-yl)-2,5-dimethoxyphenyl]-2-fluoroprop-2-enoyl]amino]propanoic acid |
| SMILES | COc1cc(-c2ccc3c(c2)CCN3)c(OC)cc1/C=C(/F)C(=O)N[C@H](C)C(=O)O |
| InChI | InChI=1S/C22H23FN2O5/c1-12(22(27)28)25-21(26)17(23)9-15-10-20(30-3)16(11-19(15)29-2)13-4-5-18-14(8-13)6-7-24-18/h4-5,8-12,24H,6-7H2,1-3H3,(H,25,26)(H,27,28)/b17-9+/t12-/m1/s1 |
| InChIKey | MIFQCXAZZHDJLF-UDPFGDFPSA-N |
| XLogP | 3.24 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|