C28H26FNO7S2 — CID 23539400
[4-[4-[3-fluoro-4-[(4-methylphenyl)sulfonylamino]phenyl]-2,5-dimethoxyphenyl]phenyl] methanesulfonate (PubChem CID 23539400) has the molecular formula C28H26FNO7S2 and a molecular weight of 571.65 g/mol. Its IUPAC name is [4-[4-[3-fluoro-4-[(4-methylphenyl)sulfonylamino]phenyl]-2,5-dimethoxyphenyl]phenyl] methanesulfonate.
| Compound Name | [4-[4-[3-fluoro-4-[(4-methylphenyl)sulfonylamino]phenyl]-2,5-dimethoxyphenyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 23539400 |
| Molecular Formula | C28H26FNO7S2 |
| Molecular Weight | 571.65 g/mol |
| Exact Mass | 571.11 |
| IUPAC Name | [4-[4-[3-fluoro-4-[(4-methylphenyl)sulfonylamino]phenyl]-2,5-dimethoxyphenyl]phenyl] methanesulfonate |
| SMILES | COc1cc(-c2ccc(NS(=O)(=O)c3ccc(C)cc3)c(F)c2)c(OC)cc1-c1ccc(OS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C28H26FNO7S2/c1-18-5-12-22(13-6-18)39(33,34)30-26-14-9-20(15-25(26)29)24-17-27(35-2)23(16-28(24)36-3)19-7-10-21(11-8-19)37-38(4,31)32/h5-17,30H,1-4H3 |
| InChIKey | VIHYTQXDJTYYES-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.65 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|