About [2-(4-methoxyphenyl)phenyl] trifluoromethanesulfonate;sulfane
[2-(4-methoxyphenyl)phenyl] trifluoromethanesulfonate;sulfane (PubChem CID 130176801) has the molecular formula C14H13F3O4S2
and a molecular weight of 366.38 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)phenyl] trifluoromethanesulfonate;sulfane.
Molecular Properties
| Compound Name | [2-(4-methoxyphenyl)phenyl] trifluoromethanesulfonate;sulfane |
| PubChem CID | 130176801 |
| Molecular Formula | C14H13F3O4S2 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | [2-(4-methoxyphenyl)phenyl] trifluoromethanesulfonate;sulfane |
| SMILES | COc1ccc(-c2ccccc2OS(=O)(=O)C(F)(F)F)cc1.S |
| InChI | InChI=1S/C14H11F3O4S.H2S/c1-20-11-8-6-10(7-9-11)12-4-2-3-5-13(12)21-22(18,19)14(15,16)17;/h2-9H,1H3;1H2 |
| InChIKey | WCXWJAUNKBVKLC-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [2-(4-methoxyphenyl)phenyl] trifluoromethanesulfonate;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-methoxyphenyl)phenyl] trifluoromethanesulfonate;sulfane?
The IUPAC name of [2-(4-methoxyphenyl)phenyl] trifluoromethanesulfonate;sulfane (CID 130176801) is [2-(4-methoxyphenyl)phenyl] trifluoromethanesulfonate;sulfane.
What is the SMILES notation for [2-(4-methoxyphenyl)phenyl] trifluoromethanesulfonate;sulfane?
The canonical SMILES for [2-(4-methoxyphenyl)phenyl] trifluoromethanesulfonate;sulfane is COc1ccc(-c2ccccc2OS(=O)(=O)C(F)(F)F)cc1.S.
What is the InChIKey of [2-(4-methoxyphenyl)phenyl] trifluoromethanesulfonate;sulfane?
The InChIKey is WCXWJAUNKBVKLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11F3O4S.H2S/c1-20-11-8-6-10(7-9-11)12-4-2-3-5-13(12)21-22(18,19)14(15,16)17;/h2-9H,1H3;1H2.
What are the key properties of [2-(4-methoxyphenyl)phenyl] trifluoromethanesulfonate;sulfane?
[2-(4-methoxyphenyl)phenyl] trifluoromethanesulfonate;sulfane has a molecular weight of 366.38 g/mol, XLogP of 3.70, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-methoxyphenyl)phenyl] trifluoromethanesulfonate;sulfane is sourced from PubChem (CID 130176801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).