C55H37F3N6O4S — CID 167591482
5-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-phenylphenol;[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-phenylphenyl] trifluoromethanesulfonate (PubChem CID 167591482) has the molecular formula C55H37F3N6O4S and a molecular weight of 935.00 g/mol. Its IUPAC name is 5-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-phenylphenol;[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-phenylphenyl] trifluoromethanesulfonate.
| Compound Name | 5-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-phenylphenol;[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-phenylphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 167591482 |
| Molecular Formula | C55H37F3N6O4S |
| Molecular Weight | 935.00 g/mol |
| Exact Mass | 934.25 |
| IUPAC Name | 5-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-phenylphenol;[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-phenylphenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)ccc1-c1ccccc1)C(F)(F)F.Oc1cc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)ccc1-c1ccccc1 |
| InChI | InChI=1S/C28H18F3N3O3S.C27H19N3O/c29-28(30,31)38(35,36)37-24-18-22(16-17-23(24)19-10-4-1-5-11-19)27-33-25(20-12-6-2-7-13-20)32-26(34-27)21-14-8-3-9-15-21;31-24-18-22(16-17-23(24)19-10-4-1-5-11-19)27-29-25(20-12-6-2-7-13-20)28-26(30-27)21-14-8-3-9-15-21/h1-18H;1-18,31H |
| InChIKey | IMNPNUAXGKWSMY-UHFFFAOYSA-N |
| XLogP | 13.01 |
| TPSA | 140.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 935.00 |
| LogP ≤ 5 | 13.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|