C28H20F3N3O3S — CID 145233243
[3-[4-(4-cyclohexa-1,5-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]phenyl] trifluoromethanesulfonate (PubChem CID 145233243) has the molecular formula C28H20F3N3O3S and a molecular weight of 535.55 g/mol. Its IUPAC name is [3-[4-(4-cyclohexa-1,5-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3-[4-(4-cyclohexa-1,5-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 145233243 |
| Molecular Formula | C28H20F3N3O3S |
| Molecular Weight | 535.55 g/mol |
| Exact Mass | 535.12 |
| IUPAC Name | [3-[4-(4-cyclohexa-1,5-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]phenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cccc(-c2ccc(-c3nc(C4=CCCC=C4)nc(-c4ccccc4)n3)cc2)c1)C(F)(F)F |
| InChI | InChI=1S/C28H20F3N3O3S/c29-28(30,31)38(35,36)37-24-13-7-12-23(18-24)19-14-16-22(17-15-19)27-33-25(20-8-3-1-4-9-20)32-26(34-27)21-10-5-2-6-11-21/h1,3-5,7-18H,2,6H2 |
| InChIKey | MCRRZPNXDURRAR-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 82.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.55 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|