C15H14BN3O2 — CID 144602933
(4-cyclohexa-1,5-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)boronic acid (PubChem CID 144602933) has the molecular formula C15H14BN3O2 and a molecular weight of 279.11 g/mol. Its IUPAC name is (4-cyclohexa-1,5-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)boronic acid.
| Compound Name | (4-cyclohexa-1,5-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)boronic acid |
|---|---|
| PubChem CID | 144602933 |
| Molecular Formula | C15H14BN3O2 |
| Molecular Weight | 279.11 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | (4-cyclohexa-1,5-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)boronic acid |
| SMILES | OB(O)c1nc(C2=CCCC=C2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C15H14BN3O2/c20-16(21)15-18-13(11-7-3-1-4-8-11)17-14(19-15)12-9-5-2-6-10-12/h1,3-5,7-10,20-21H,2,6H2 |
| InChIKey | SVOLJEVIJFVHIE-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 79.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.11 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|