C47H34N4 — CID 145055582
9-[10-[4-(4-cyclohexa-1,5-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-1,4-dihydroanthracen-9-yl]carbazole (PubChem CID 145055582) has the molecular formula C47H34N4 and a molecular weight of 654.82 g/mol. Its IUPAC name is 9-[10-[4-(4-cyclohexa-1,5-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-1,4-dihydroanthracen-9-yl]carbazole.
| Compound Name | 9-[10-[4-(4-cyclohexa-1,5-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-1,4-dihydroanthracen-9-yl]carbazole |
|---|---|
| PubChem CID | 145055582 |
| Molecular Formula | C47H34N4 |
| Molecular Weight | 654.82 g/mol |
| Exact Mass | 654.28 |
| IUPAC Name | 9-[10-[4-(4-cyclohexa-1,5-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-1,4-dihydroanthracen-9-yl]carbazole |
| SMILES | C1=CC(c2nc(-c3ccccc3)nc(-c3ccc(-c4c5c(c(-n6c7ccccc7c7ccccc76)c6ccccc46)CC=CC5)cc3)n2)=CCC1 |
| InChI | InChI=1S/C47H34N4/c1-3-15-32(16-4-1)45-48-46(33-17-5-2-6-18-33)50-47(49-45)34-29-27-31(28-30-34)43-37-21-7-9-23-39(37)44(40-24-10-8-22-38(40)43)51-41-25-13-11-19-35(41)36-20-12-14-26-42(36)51/h1,3-5,7-21,23,25-30H,2,6,22,24H2 |
| InChIKey | RWQAIDBHHXKDTN-UHFFFAOYSA-N |
| XLogP | 11.51 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.82 |
| LogP ≤ 5 | 11.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|