C45H32N4 — CID 174355929
9-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-2-cyclohexa-1,5-dien-1-ylcarbazole (PubChem CID 174355929) has the molecular formula C45H32N4 and a molecular weight of 628.78 g/mol. Its IUPAC name is 9-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-2-cyclohexa-1,5-dien-1-ylcarbazole.
| Compound Name | 9-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-2-cyclohexa-1,5-dien-1-ylcarbazole |
|---|---|
| PubChem CID | 174355929 |
| Molecular Formula | C45H32N4 |
| Molecular Weight | 628.78 g/mol |
| Exact Mass | 628.26 |
| IUPAC Name | 9-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-2-cyclohexa-1,5-dien-1-ylcarbazole |
| SMILES | C1=CC(c2ccc3c4ccccc4n(-c4nc(-c5ccc(-c6ccccc6)cc5)nc(-c5ccc(-c6ccccc6)cc5)n4)c3c2)=CCC1 |
| InChI | InChI=1S/C45H32N4/c1-4-12-31(13-5-1)34-20-24-36(25-21-34)43-46-44(37-26-22-35(23-27-37)32-14-6-2-7-15-32)48-45(47-43)49-41-19-11-10-18-39(41)40-29-28-38(30-42(40)49)33-16-8-3-9-17-33/h1-2,4-8,10-30H,3,9H2 |
| InChIKey | SNYWKUCHJMAHRB-UHFFFAOYSA-N |
| XLogP | 11.37 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.78 |
| LogP ≤ 5 | 11.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |