C33H21BrN4 — CID 163781503
2-(4-bromophenyl)-9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole (PubChem CID 163781503) has the molecular formula C33H21BrN4 and a molecular weight of 553.46 g/mol. Its IUPAC name is 2-(4-bromophenyl)-9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole.
| Compound Name | 2-(4-bromophenyl)-9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole |
|---|---|
| PubChem CID | 163781503 |
| Molecular Formula | C33H21BrN4 |
| Molecular Weight | 553.46 g/mol |
| Exact Mass | 552.09 |
| IUPAC Name | 2-(4-bromophenyl)-9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole |
| SMILES | Brc1ccc(-c2ccc3c4ccccc4n(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3c2)cc1 |
| InChI | InChI=1S/C33H21BrN4/c34-26-18-15-22(16-19-26)25-17-20-28-27-13-7-8-14-29(27)38(30(28)21-25)33-36-31(23-9-3-1-4-10-23)35-32(37-33)24-11-5-2-6-12-24/h1-21H |
| InChIKey | MOYOIGNRJMFJRM-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.46 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |