C28H18F3N3O3S — CID 166504739
[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-phenylphenyl] trifluoromethanesulfonate (PubChem CID 166504739) has the molecular formula C28H18F3N3O3S and a molecular weight of 533.53 g/mol. Its IUPAC name is [4-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-phenylphenyl] trifluoromethanesulfonate.
| Compound Name | [4-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-phenylphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 166504739 |
| Molecular Formula | C28H18F3N3O3S |
| Molecular Weight | 533.53 g/mol |
| Exact Mass | 533.10 |
| IUPAC Name | [4-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-phenylphenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c(-c2ccccc2)c1)C(F)(F)F |
| InChI | InChI=1S/C28H18F3N3O3S/c29-28(30,31)38(35,36)37-22-16-17-23(24(18-22)19-10-4-1-5-11-19)27-33-25(20-12-6-2-7-13-20)32-26(34-27)21-14-8-3-9-15-21/h1-18H |
| InChIKey | SSMULYHWWWPLQP-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 82.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.53 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|