C14H9F3O5S — CID 91609871
4-phenyl-3-(trifluoromethylsulfonyloxy)benzoic acid (PubChem CID 91609871) has the molecular formula C14H9F3O5S and a molecular weight of 346.28 g/mol. Its IUPAC name is 4-phenyl-3-(trifluoromethylsulfonyloxy)benzoic acid.
| Compound Name | 4-phenyl-3-(trifluoromethylsulfonyloxy)benzoic acid |
|---|---|
| PubChem CID | 91609871 |
| Molecular Formula | C14H9F3O5S |
| Molecular Weight | 346.28 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | 4-phenyl-3-(trifluoromethylsulfonyloxy)benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccccc2)c(OS(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C14H9F3O5S/c15-14(16,17)23(20,21)22-12-8-10(13(18)19)6-7-11(12)9-4-2-1-3-5-9/h1-8H,(H,18,19) |
| InChIKey | VLIZNFAQSDRFPQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.28 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|