C15H13ClF3NO2 — CID 141118952
4-phenyl-3-(2,2,2-trifluoroethoxy)benzamide;hydrochloride (PubChem CID 141118952) has the molecular formula C15H13ClF3NO2 and a molecular weight of 331.72 g/mol. Its IUPAC name is 4-phenyl-3-(2,2,2-trifluoroethoxy)benzamide;hydrochloride.
| Compound Name | 4-phenyl-3-(2,2,2-trifluoroethoxy)benzamide;hydrochloride |
|---|---|
| PubChem CID | 141118952 |
| Molecular Formula | C15H13ClF3NO2 |
| Molecular Weight | 331.72 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 4-phenyl-3-(2,2,2-trifluoroethoxy)benzamide;hydrochloride |
| SMILES | Cl.NC(=O)c1ccc(-c2ccccc2)c(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C15H12F3NO2.ClH/c16-15(17,18)9-21-13-8-11(14(19)20)6-7-12(13)10-4-2-1-3-5-10;/h1-8H,9H2,(H2,19,20);1H |
| InChIKey | ILFFBTJVTBYGKW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.72 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |