C13H14F3NO3 — CID 68981863
3-(cyclopropylmethoxy)-4-(2,2,2-trifluoroethoxy)benzamide (PubChem CID 68981863) has the molecular formula C13H14F3NO3 and a molecular weight of 289.25 g/mol. Its IUPAC name is 3-(cyclopropylmethoxy)-4-(2,2,2-trifluoroethoxy)benzamide.
| Compound Name | 3-(cyclopropylmethoxy)-4-(2,2,2-trifluoroethoxy)benzamide |
|---|---|
| PubChem CID | 68981863 |
| Molecular Formula | C13H14F3NO3 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 3-(cyclopropylmethoxy)-4-(2,2,2-trifluoroethoxy)benzamide |
| SMILES | NC(=O)c1ccc(OCC(F)(F)F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C13H14F3NO3/c14-13(15,16)7-20-10-4-3-9(12(17)18)5-11(10)19-6-8-1-2-8/h3-5,8H,1-2,6-7H2,(H2,17,18) |
| InChIKey | DKSJUQHGCUSLBJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |