C13H9F3N4O2 — CID 168542826
3-(2,2-dicyanoethenylamino)-4-(2,2,2-trifluoroethoxy)benzamide (PubChem CID 168542826) has the molecular formula C13H9F3N4O2 and a molecular weight of 310.24 g/mol. Its IUPAC name is 3-(2,2-dicyanoethenylamino)-4-(2,2,2-trifluoroethoxy)benzamide.
| Compound Name | 3-(2,2-dicyanoethenylamino)-4-(2,2,2-trifluoroethoxy)benzamide |
|---|---|
| PubChem CID | 168542826 |
| Molecular Formula | C13H9F3N4O2 |
| Molecular Weight | 310.24 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 3-(2,2-dicyanoethenylamino)-4-(2,2,2-trifluoroethoxy)benzamide |
| SMILES | N#CC(C#N)=CNc1cc(C(N)=O)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C13H9F3N4O2/c14-13(15,16)7-22-11-2-1-9(12(19)21)3-10(11)20-6-8(4-17)5-18/h1-3,6,20H,7H2,(H2,19,21) |
| InChIKey | ZZQLNBJNYJMNFH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 111.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.24 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|