C15H15N3O3 — CID 168543002
3-(2,2-dicyanoethenylamino)-4-(2-methylpropoxy)benzoic acid (PubChem CID 168543002) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is 3-(2,2-dicyanoethenylamino)-4-(2-methylpropoxy)benzoic acid.
| Compound Name | 3-(2,2-dicyanoethenylamino)-4-(2-methylpropoxy)benzoic acid |
|---|---|
| PubChem CID | 168543002 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 3-(2,2-dicyanoethenylamino)-4-(2-methylpropoxy)benzoic acid |
| SMILES | CC(C)COc1ccc(C(=O)O)cc1NC=C(C#N)C#N |
| InChI | InChI=1S/C15H15N3O3/c1-10(2)9-21-14-4-3-12(15(19)20)5-13(14)18-8-11(6-16)7-17/h3-5,8,10,18H,9H2,1-2H3,(H,19,20) |
| InChIKey | FMFACGMTOZNXHT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|