C18H14N4O2 — CID 168541185
3-(2,2-dicyanoethenylamino)-4-methoxy-N-phenylbenzamide (PubChem CID 168541185) has the molecular formula C18H14N4O2 and a molecular weight of 318.34 g/mol. Its IUPAC name is 3-(2,2-dicyanoethenylamino)-4-methoxy-N-phenylbenzamide.
| Compound Name | 3-(2,2-dicyanoethenylamino)-4-methoxy-N-phenylbenzamide |
|---|---|
| PubChem CID | 168541185 |
| Molecular Formula | C18H14N4O2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 3-(2,2-dicyanoethenylamino)-4-methoxy-N-phenylbenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccccc2)cc1NC=C(C#N)C#N |
| InChI | InChI=1S/C18H14N4O2/c1-24-17-8-7-14(9-16(17)21-12-13(10-19)11-20)18(23)22-15-5-3-2-4-6-15/h2-9,12,21H,1H3,(H,22,23) |
| InChIKey | DODRFMYGXHBHMF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 97.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|