C22H19N3O4S — CID 54445185
3-[[2-methoxy-5-(phenylcarbamoyl)phenyl]carbamothioylamino]benzoic acid (PubChem CID 54445185) has the molecular formula C22H19N3O4S and a molecular weight of 421.48 g/mol. Its IUPAC name is 3-[[2-methoxy-5-(phenylcarbamoyl)phenyl]carbamothioylamino]benzoic acid.
| Compound Name | 3-[[2-methoxy-5-(phenylcarbamoyl)phenyl]carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 54445185 |
| Molecular Formula | C22H19N3O4S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 3-[[2-methoxy-5-(phenylcarbamoyl)phenyl]carbamothioylamino]benzoic acid |
| SMILES | COc1ccc(C(=O)Nc2ccccc2)cc1NC(=S)Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C22H19N3O4S/c1-29-19-11-10-14(20(26)23-16-7-3-2-4-8-16)13-18(19)25-22(30)24-17-9-5-6-15(12-17)21(27)28/h2-13H,1H3,(H,23,26)(H,27,28)(H2,24,25,30) |
| InChIKey | WQZGZCIVCVEQJK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|