C17H19N3O5 — CID 168544992
2,3-dihydroxypropyl 3-(2,2-dicyanoethenylamino)-4-propoxybenzoate (PubChem CID 168544992) has the molecular formula C17H19N3O5 and a molecular weight of 345.36 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 3-(2,2-dicyanoethenylamino)-4-propoxybenzoate.
| Compound Name | 2,3-dihydroxypropyl 3-(2,2-dicyanoethenylamino)-4-propoxybenzoate |
|---|---|
| PubChem CID | 168544992 |
| Molecular Formula | C17H19N3O5 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 2,3-dihydroxypropyl 3-(2,2-dicyanoethenylamino)-4-propoxybenzoate |
| SMILES | CCCOc1ccc(C(=O)OCC(O)CO)cc1NC=C(C#N)C#N |
| InChI | InChI=1S/C17H19N3O5/c1-2-5-24-16-4-3-13(17(23)25-11-14(22)10-21)6-15(16)20-9-12(7-18)8-19/h3-4,6,9,14,20-22H,2,5,10-11H2,1H3 |
| InChIKey | DOXQUFJZRKQNAV-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 135.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|