C16H25NO7 — CID 168594330
2,3-dihydroxypropyl 3-(2,3-dihydroxypropylamino)-4-propoxybenzoate (PubChem CID 168594330) has the molecular formula C16H25NO7 and a molecular weight of 343.38 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 3-(2,3-dihydroxypropylamino)-4-propoxybenzoate.
| Compound Name | 2,3-dihydroxypropyl 3-(2,3-dihydroxypropylamino)-4-propoxybenzoate |
|---|---|
| PubChem CID | 168594330 |
| Molecular Formula | C16H25NO7 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 2,3-dihydroxypropyl 3-(2,3-dihydroxypropylamino)-4-propoxybenzoate |
| SMILES | CCCOc1ccc(C(=O)OCC(O)CO)cc1NCC(O)CO |
| InChI | InChI=1S/C16H25NO7/c1-2-5-23-15-4-3-11(16(22)24-10-13(21)9-19)6-14(15)17-7-12(20)8-18/h3-4,6,12-13,17-21H,2,5,7-10H2,1H3 |
| InChIKey | KVTZDEPFBNNRKQ-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |