C11H14INO4 — CID 168597515
methyl 4-(2,3-dihydroxypropylamino)-3-iodobenzoate (PubChem CID 168597515) has the molecular formula C11H14INO4 and a molecular weight of 351.14 g/mol. Its IUPAC name is methyl 4-(2,3-dihydroxypropylamino)-3-iodobenzoate.
| Compound Name | methyl 4-(2,3-dihydroxypropylamino)-3-iodobenzoate |
|---|---|
| PubChem CID | 168597515 |
| Molecular Formula | C11H14INO4 |
| Molecular Weight | 351.14 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | methyl 4-(2,3-dihydroxypropylamino)-3-iodobenzoate |
| SMILES | COC(=O)c1ccc(NCC(O)CO)c(I)c1 |
| InChI | InChI=1S/C11H14INO4/c1-17-11(16)7-2-3-10(9(12)4-7)13-5-8(15)6-14/h2-4,8,13-15H,5-6H2,1H3 |
| InChIKey | ORHDPPZPRWAZQC-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.14 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|