C15H21NO6 — CID 168594671
diethyl 4-(2,3-dihydroxypropylamino)benzene-1,3-dicarboxylate (PubChem CID 168594671) has the molecular formula C15H21NO6 and a molecular weight of 311.33 g/mol. Its IUPAC name is diethyl 4-(2,3-dihydroxypropylamino)benzene-1,3-dicarboxylate.
| Compound Name | diethyl 4-(2,3-dihydroxypropylamino)benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 168594671 |
| Molecular Formula | C15H21NO6 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | diethyl 4-(2,3-dihydroxypropylamino)benzene-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1ccc(NCC(O)CO)c(C(=O)OCC)c1 |
| InChI | InChI=1S/C15H21NO6/c1-3-21-14(19)10-5-6-13(16-8-11(18)9-17)12(7-10)15(20)22-4-2/h5-7,11,16-18H,3-4,8-9H2,1-2H3 |
| InChIKey | YXCSIKYCTRRQIO-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |