C12H17NO4 — CID 168597111
1-[4-(2,3-dihydroxypropylamino)-3-methoxyphenyl]ethanone (PubChem CID 168597111) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is 1-[4-(2,3-dihydroxypropylamino)-3-methoxyphenyl]ethanone.
| Compound Name | 1-[4-(2,3-dihydroxypropylamino)-3-methoxyphenyl]ethanone |
|---|---|
| PubChem CID | 168597111 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 1-[4-(2,3-dihydroxypropylamino)-3-methoxyphenyl]ethanone |
| SMILES | COc1cc(C(C)=O)ccc1NCC(O)CO |
| InChI | InChI=1S/C12H17NO4/c1-8(15)9-3-4-11(12(5-9)17-2)13-6-10(16)7-14/h3-5,10,13-14,16H,6-7H2,1-2H3 |
| InChIKey | GAEFJVHZZCDLTB-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |