C15H23NO3 — CID 168597514
1-[3-tert-butyl-4-(2,3-dihydroxypropylamino)phenyl]ethanone (PubChem CID 168597514) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is 1-[3-tert-butyl-4-(2,3-dihydroxypropylamino)phenyl]ethanone.
| Compound Name | 1-[3-tert-butyl-4-(2,3-dihydroxypropylamino)phenyl]ethanone |
|---|---|
| PubChem CID | 168597514 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 1-[3-tert-butyl-4-(2,3-dihydroxypropylamino)phenyl]ethanone |
| SMILES | CC(=O)c1ccc(NCC(O)CO)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C15H23NO3/c1-10(18)11-5-6-14(16-8-12(19)9-17)13(7-11)15(2,3)4/h5-7,12,16-17,19H,8-9H2,1-4H3 |
| InChIKey | IXUCVSZQZLDWIO-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |