C11H10INO5 — CID 142435905
3-(2-iodo-4-methoxycarbonylanilino)-3-oxopropanoic acid (PubChem CID 142435905) has the molecular formula C11H10INO5 and a molecular weight of 363.11 g/mol. Its IUPAC name is 3-(2-iodo-4-methoxycarbonylanilino)-3-oxopropanoic acid.
| Compound Name | 3-(2-iodo-4-methoxycarbonylanilino)-3-oxopropanoic acid |
|---|---|
| PubChem CID | 142435905 |
| Molecular Formula | C11H10INO5 |
| Molecular Weight | 363.11 g/mol |
| Exact Mass | 362.96 |
| IUPAC Name | 3-(2-iodo-4-methoxycarbonylanilino)-3-oxopropanoic acid |
| SMILES | COC(=O)c1ccc(NC(=O)CC(=O)O)c(I)c1 |
| InChI | InChI=1S/C11H10INO5/c1-18-11(17)6-2-3-8(7(12)4-6)13-9(14)5-10(15)16/h2-4H,5H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | XIEXWBLDZCPBKV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.11 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|