C17H20O6 — CID 168528271
2,3-dihydroxypropyl 3-(furan-2-yl)-4-propoxybenzoate (PubChem CID 168528271) has the molecular formula C17H20O6 and a molecular weight of 320.34 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 3-(furan-2-yl)-4-propoxybenzoate.
| Compound Name | 2,3-dihydroxypropyl 3-(furan-2-yl)-4-propoxybenzoate |
|---|---|
| PubChem CID | 168528271 |
| Molecular Formula | C17H20O6 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 2,3-dihydroxypropyl 3-(furan-2-yl)-4-propoxybenzoate |
| SMILES | CCCOc1ccc(C(=O)OCC(O)CO)cc1-c1ccco1 |
| InChI | InChI=1S/C17H20O6/c1-2-7-21-16-6-5-12(17(20)23-11-13(19)10-18)9-14(16)15-4-3-8-22-15/h3-6,8-9,13,18-19H,2,7,10-11H2,1H3 |
| InChIKey | XRHCQVHDTUIYPP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |