C16H18N6O3 — CID 169345441
3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-4-(3-methylbutoxy)benzoic acid (PubChem CID 169345441) has the molecular formula C16H18N6O3 and a molecular weight of 342.36 g/mol. Its IUPAC name is 3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-4-(3-methylbutoxy)benzoic acid.
| Compound Name | 3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-4-(3-methylbutoxy)benzoic acid |
|---|---|
| PubChem CID | 169345441 |
| Molecular Formula | C16H18N6O3 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-4-(3-methylbutoxy)benzoic acid |
| SMILES | CC(C)CCOc1ccc(C(=O)O)cc1NC=C(C#N)c1nn[nH]n1 |
| InChI | InChI=1S/C16H18N6O3/c1-10(2)5-6-25-14-4-3-11(16(23)24)7-13(14)18-9-12(8-17)15-19-21-22-20-15/h3-4,7,9-10,18H,5-6H2,1-2H3,(H,23,24)(H,19,20,21,22) |
| InChIKey | VIMGDKDFSKKNTC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 136.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|