C15H16N6O2 — CID 169346904
tert-butyl 4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]benzoate (PubChem CID 169346904) has the molecular formula C15H16N6O2 and a molecular weight of 312.33 g/mol. Its IUPAC name is tert-butyl 4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]benzoate.
| Compound Name | tert-butyl 4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]benzoate |
|---|---|
| PubChem CID | 169346904 |
| Molecular Formula | C15H16N6O2 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | tert-butyl 4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(NC=C(C#N)c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C15H16N6O2/c1-15(2,3)23-14(22)10-4-6-12(7-5-10)17-9-11(8-16)13-18-20-21-19-13/h4-7,9,17H,1-3H3,(H,18,19,20,21) |
| InChIKey | GGNOCJRMDPZYQL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 116.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|