C17H13N7O2S — CID 169344128
methyl 2-[4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]sulfanylpyridine-4-carboxylate (PubChem CID 169344128) has the molecular formula C17H13N7O2S and a molecular weight of 379.41 g/mol. Its IUPAC name is methyl 2-[4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]sulfanylpyridine-4-carboxylate.
| Compound Name | methyl 2-[4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]sulfanylpyridine-4-carboxylate |
|---|---|
| PubChem CID | 169344128 |
| Molecular Formula | C17H13N7O2S |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | methyl 2-[4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]sulfanylpyridine-4-carboxylate |
| SMILES | COC(=O)c1ccnc(Sc2ccc(NC=C(C#N)c3nn[nH]n3)cc2)c1 |
| InChI | InChI=1S/C17H13N7O2S/c1-26-17(25)11-6-7-19-15(8-11)27-14-4-2-13(3-5-14)20-10-12(9-18)16-21-23-24-22-16/h2-8,10,20H,1H3,(H,21,22,23,24) |
| InChIKey | MJIYREVYCVZVIP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 129.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|