C14H12N6O4 — CID 169346788
dimethyl 5-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]benzene-1,3-dicarboxylate (PubChem CID 169346788) has the molecular formula C14H12N6O4 and a molecular weight of 328.29 g/mol. Its IUPAC name is dimethyl 5-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 169346788 |
| Molecular Formula | C14H12N6O4 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | dimethyl 5-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC=C(C#N)c2nn[nH]n2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C14H12N6O4/c1-23-13(21)8-3-9(14(22)24-2)5-11(4-8)16-7-10(6-15)12-17-19-20-18-12/h3-5,7,16H,1-2H3,(H,17,18,19,20) |
| InChIKey | FNRKEAGXVNAESF-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 142.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|