C19H15BrN6O3 — CID 169344382
methyl 3-bromo-4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-5-phenylmethoxybenzoate (PubChem CID 169344382) has the molecular formula C19H15BrN6O3 and a molecular weight of 455.27 g/mol. Its IUPAC name is methyl 3-bromo-4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-5-phenylmethoxybenzoate.
| Compound Name | methyl 3-bromo-4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-5-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 169344382 |
| Molecular Formula | C19H15BrN6O3 |
| Molecular Weight | 455.27 g/mol |
| Exact Mass | 454.04 |
| IUPAC Name | methyl 3-bromo-4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-5-phenylmethoxybenzoate |
| SMILES | COC(=O)c1cc(Br)c(NC=C(C#N)c2nn[nH]n2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C19H15BrN6O3/c1-28-19(27)13-7-15(20)17(22-10-14(9-21)18-23-25-26-24-18)16(8-13)29-11-12-5-3-2-4-6-12/h2-8,10,22H,11H2,1H3,(H,23,24,25,26) |
| InChIKey | AHUWNZFYNRAYRH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 125.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.27 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|