C19H14IN3O3 — CID 168542705
methyl 4-(2,2-dicyanoethenylamino)-3-iodo-5-phenylmethoxybenzoate (PubChem CID 168542705) has the molecular formula C19H14IN3O3 and a molecular weight of 459.24 g/mol. Its IUPAC name is methyl 4-(2,2-dicyanoethenylamino)-3-iodo-5-phenylmethoxybenzoate.
| Compound Name | methyl 4-(2,2-dicyanoethenylamino)-3-iodo-5-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 168542705 |
| Molecular Formula | C19H14IN3O3 |
| Molecular Weight | 459.24 g/mol |
| Exact Mass | 459.01 |
| IUPAC Name | methyl 4-(2,2-dicyanoethenylamino)-3-iodo-5-phenylmethoxybenzoate |
| SMILES | COC(=O)c1cc(I)c(NC=C(C#N)C#N)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C19H14IN3O3/c1-25-19(24)15-7-16(20)18(23-11-14(9-21)10-22)17(8-15)26-12-13-5-3-2-4-6-13/h2-8,11,23H,12H2,1H3 |
| InChIKey | QRAFQNXIPAHEIG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.24 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|