C20H13IN4O3 — CID 168607815
methyl 3-iodo-5-phenylmethoxy-4-(1,2,2-tricyanoethenylamino)benzoate (PubChem CID 168607815) has the molecular formula C20H13IN4O3 and a molecular weight of 484.25 g/mol. Its IUPAC name is methyl 3-iodo-5-phenylmethoxy-4-(1,2,2-tricyanoethenylamino)benzoate.
| Compound Name | methyl 3-iodo-5-phenylmethoxy-4-(1,2,2-tricyanoethenylamino)benzoate |
|---|---|
| PubChem CID | 168607815 |
| Molecular Formula | C20H13IN4O3 |
| Molecular Weight | 484.25 g/mol |
| Exact Mass | 484.00 |
| IUPAC Name | methyl 3-iodo-5-phenylmethoxy-4-(1,2,2-tricyanoethenylamino)benzoate |
| SMILES | COC(=O)c1cc(I)c(NC(C#N)=C(C#N)C#N)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C20H13IN4O3/c1-27-20(26)14-7-16(21)19(25-17(11-24)15(9-22)10-23)18(8-14)28-12-13-5-3-2-4-6-13/h2-8,25H,12H2,1H3 |
| InChIKey | XXLSONCIEWEUBW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 118.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.25 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|