C13H11BrN6O3 — CID 169343982
methyl 5-bromo-2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-4-methoxybenzoate (PubChem CID 169343982) has the molecular formula C13H11BrN6O3 and a molecular weight of 379.17 g/mol. Its IUPAC name is methyl 5-bromo-2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-4-methoxybenzoate.
| Compound Name | methyl 5-bromo-2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-4-methoxybenzoate |
|---|---|
| PubChem CID | 169343982 |
| Molecular Formula | C13H11BrN6O3 |
| Molecular Weight | 379.17 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | methyl 5-bromo-2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-4-methoxybenzoate |
| SMILES | COC(=O)c1cc(Br)c(OC)cc1NC=C(C#N)c1nn[nH]n1 |
| InChI | InChI=1S/C13H11BrN6O3/c1-22-11-4-10(8(3-9(11)14)13(21)23-2)16-6-7(5-15)12-17-19-20-18-12/h3-4,6,16H,1-2H3,(H,17,18,19,20) |
| InChIKey | JAVVWABURMUCSW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 125.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.17 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|