C14H11F3N6O2 — CID 169342990
methyl 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-5-methyl-4-(trifluoromethyl)benzoate (PubChem CID 169342990) has the molecular formula C14H11F3N6O2 and a molecular weight of 352.28 g/mol. Its IUPAC name is methyl 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-5-methyl-4-(trifluoromethyl)benzoate.
| Compound Name | methyl 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-5-methyl-4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 169342990 |
| Molecular Formula | C14H11F3N6O2 |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | methyl 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-5-methyl-4-(trifluoromethyl)benzoate |
| SMILES | COC(=O)c1cc(C)c(C(F)(F)F)cc1NC=C(C#N)c1nn[nH]n1 |
| InChI | InChI=1S/C14H11F3N6O2/c1-7-3-9(13(24)25-2)11(4-10(7)14(15,16)17)19-6-8(5-18)12-20-22-23-21-12/h3-4,6,19H,1-2H3,(H,20,21,22,23) |
| InChIKey | PEZNXXMETXPHAU-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 116.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|