C13H13N7O2S — CID 169346631
2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-4,5-dimethoxybenzenecarbothioamide (PubChem CID 169346631) has the molecular formula C13H13N7O2S and a molecular weight of 331.36 g/mol. Its IUPAC name is 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-4,5-dimethoxybenzenecarbothioamide.
| Compound Name | 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-4,5-dimethoxybenzenecarbothioamide |
|---|---|
| PubChem CID | 169346631 |
| Molecular Formula | C13H13N7O2S |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-4,5-dimethoxybenzenecarbothioamide |
| SMILES | COc1cc(NC=C(C#N)c2nn[nH]n2)c(C(N)=S)cc1OC |
| InChI | InChI=1S/C13H13N7O2S/c1-21-10-3-8(12(15)23)9(4-11(10)22-2)16-6-7(5-14)13-17-19-20-18-13/h3-4,6,16H,1-2H3,(H2,15,23)(H,17,18,19,20) |
| InChIKey | GXHVWRXHRZSTQD-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 134.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|