About 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-3-fluoro-4,5-dimethoxybenzamide
2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-3-fluoro-4,5-dimethoxybenzamide (PubChem CID 169345786) has the molecular formula C13H12FN7O3
and a molecular weight of 333.28 g/mol. Its IUPAC name is 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-3-fluoro-4,5-dimethoxybenzamide.
Molecular Properties
| Compound Name | 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-3-fluoro-4,5-dimethoxybenzamide |
| PubChem CID | 169345786 |
| Molecular Formula | C13H12FN7O3 |
| Molecular Weight | 333.28 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-3-fluoro-4,5-dimethoxybenzamide |
| SMILES | COc1cc(C(N)=O)c(NC=C(C#N)c2nn[nH]n2)c(F)c1OC |
| InChI | InChI=1S/C13H12FN7O3/c1-23-8-3-7(12(16)22)10(9(14)11(8)24-2)17-5-6(4-15)13-18-20-21-19-13/h3,5,17H,1-2H3,(H2,16,22)(H,18,19,20,21) |
| InChIKey | JWSQINRFRSKLBY-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 151.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.28 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-3-fluoro-4,5-dimethoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-3-fluoro-4,5-dimethoxybenzamide?
The IUPAC name of 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-3-fluoro-4,5-dimethoxybenzamide (CID 169345786) is 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-3-fluoro-4,5-dimethoxybenzamide.
What is the SMILES notation for 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-3-fluoro-4,5-dimethoxybenzamide?
The canonical SMILES for 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-3-fluoro-4,5-dimethoxybenzamide is COc1cc(C(N)=O)c(NC=C(C#N)c2nn[nH]n2)c(F)c1OC.
What is the InChIKey of 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-3-fluoro-4,5-dimethoxybenzamide?
The InChIKey is JWSQINRFRSKLBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12FN7O3/c1-23-8-3-7(12(16)22)10(9(14)11(8)24-2)17-5-6(4-15)13-18-20-21-19-13/h3,5,17H,1-2H3,(H2,16,22)(H,18,19,20,21).
What are the key properties of 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-3-fluoro-4,5-dimethoxybenzamide?
2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-3-fluoro-4,5-dimethoxybenzamide has a molecular weight of 333.28 g/mol, XLogP of 0.43, 6 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-3-fluoro-4,5-dimethoxybenzamide is sourced from PubChem (CID 169345786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).