C16H16N8O3 — CID 169346051
tert-butyl N-[5-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-1,2-benzoxazol-3-yl]carbamate (PubChem CID 169346051) has the molecular formula C16H16N8O3 and a molecular weight of 368.36 g/mol. Its IUPAC name is tert-butyl N-[5-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-1,2-benzoxazol-3-yl]carbamate.
| Compound Name | tert-butyl N-[5-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-1,2-benzoxazol-3-yl]carbamate |
|---|---|
| PubChem CID | 169346051 |
| Molecular Formula | C16H16N8O3 |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | tert-butyl N-[5-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-1,2-benzoxazol-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1noc2ccc(NC=C(C#N)c3nn[nH]n3)cc12 |
| InChI | InChI=1S/C16H16N8O3/c1-16(2,3)26-15(25)19-14-11-6-10(4-5-12(11)27-22-14)18-8-9(7-17)13-20-23-24-21-13/h4-6,8,18H,1-3H3,(H,19,22,25)(H,20,21,23,24) |
| InChIKey | PBSHYAZIEOGKRQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 154.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|