C13H15N3O4 — CID 168652006
tert-butyl N-(5-formamido-1,2-benzoxazol-3-yl)carbamate (PubChem CID 168652006) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is tert-butyl N-(5-formamido-1,2-benzoxazol-3-yl)carbamate.
| Compound Name | tert-butyl N-(5-formamido-1,2-benzoxazol-3-yl)carbamate |
|---|---|
| PubChem CID | 168652006 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | tert-butyl N-(5-formamido-1,2-benzoxazol-3-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1noc2ccc(NC=O)cc12 |
| InChI | InChI=1S/C13H15N3O4/c1-13(2,3)19-12(18)15-11-9-6-8(14-7-17)4-5-10(9)20-16-11/h4-7H,1-3H3,(H,14,17)(H,15,16,18) |
| InChIKey | AYZMQHBHGZDCDF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|