C18H25BN2O5 — CID 131747412
tert-butyl N-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-benzoxazol-3-yl]carbamate (PubChem CID 131747412) has the molecular formula C18H25BN2O5 and a molecular weight of 360.22 g/mol. Its IUPAC name is tert-butyl N-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-benzoxazol-3-yl]carbamate.
| Compound Name | tert-butyl N-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-benzoxazol-3-yl]carbamate |
|---|---|
| PubChem CID | 131747412 |
| Molecular Formula | C18H25BN2O5 |
| Molecular Weight | 360.22 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | tert-butyl N-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-benzoxazol-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1noc2c(B3OC(C)(C)C(C)(C)O3)cccc12 |
| InChI | InChI=1S/C18H25BN2O5/c1-16(2,3)23-15(22)20-14-11-9-8-10-12(13(11)24-21-14)19-25-17(4,5)18(6,7)26-19/h8-10H,1-7H3,(H,20,21,22) |
| InChIKey | RWSSZESEDBVNFF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 82.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.22 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|