C19H26BF2N3O4 — CID 171108179
tert-butyl N-[1-(difluoromethyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazol-2-yl]carbamate (PubChem CID 171108179) has the molecular formula C19H26BF2N3O4 and a molecular weight of 409.24 g/mol. Its IUPAC name is tert-butyl N-[1-(difluoromethyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazol-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(difluoromethyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazol-2-yl]carbamate |
|---|---|
| PubChem CID | 171108179 |
| Molecular Formula | C19H26BF2N3O4 |
| Molecular Weight | 409.24 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | tert-butyl N-[1-(difluoromethyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazol-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1nc2cccc(B3OC(C)(C)C(C)(C)O3)c2n1C(F)F |
| InChI | InChI=1S/C19H26BF2N3O4/c1-17(2,3)27-16(26)24-15-23-12-10-8-9-11(13(12)25(15)14(21)22)20-28-18(4,5)19(6,7)29-20/h8-10,14H,1-7H3,(H,23,24,26) |
| InChIKey | AWZZNPJWAVCBAR-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.24 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|