C22H32BNO4 — CID 123931065
tert-butyl N-[(E)-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-naphthalen-1-ylidene]methyl]carbamate (PubChem CID 123931065) has the molecular formula C22H32BNO4 and a molecular weight of 385.31 g/mol. Its IUPAC name is tert-butyl N-[(E)-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-naphthalen-1-ylidene]methyl]carbamate.
| Compound Name | tert-butyl N-[(E)-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-naphthalen-1-ylidene]methyl]carbamate |
|---|---|
| PubChem CID | 123931065 |
| Molecular Formula | C22H32BNO4 |
| Molecular Weight | 385.31 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | tert-butyl N-[(E)-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-naphthalen-1-ylidene]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N/C=C1\CCCc2c(B3OC(C)(C)C(C)(C)O3)cccc21 |
| InChI | InChI=1S/C22H32BNO4/c1-20(2,3)26-19(25)24-14-15-10-8-12-17-16(15)11-9-13-18(17)23-27-21(4,5)22(6,7)28-23/h9,11,13-14H,8,10,12H2,1-7H3,(H,24,25)/b15-14+ |
| InChIKey | PRKGRWLABOEDEM-CCEZHUSRSA-N |
| XLogP | 4.19 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.31 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|