C20H30BNO4 — CID 175190815
[(1R)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-1-yl] N-tert-butylcarbamate (PubChem CID 175190815) has the molecular formula C20H30BNO4 and a molecular weight of 359.28 g/mol. Its IUPAC name is [(1R)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-1-yl] N-tert-butylcarbamate.
| Compound Name | [(1R)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-1-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 175190815 |
| Molecular Formula | C20H30BNO4 |
| Molecular Weight | 359.28 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | [(1R)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-1-yl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)O[C@@H]1CCc2c(B3OC(C)(C)C(C)(C)O3)cccc21 |
| InChI | InChI=1S/C20H30BNO4/c1-18(2,3)22-17(23)24-16-12-11-13-14(16)9-8-10-15(13)21-25-19(4,5)20(6,7)26-21/h8-10,16H,11-12H2,1-7H3,(H,22,23)/t16-/m1/s1 |
| InChIKey | AZEOQOYBEFCDHE-MRXNPFEDSA-N |
| XLogP | 3.50 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.28 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|