C21H31BFNO4 — CID 140840545
[3-fluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclobutyl] N-tert-butylcarbamate (PubChem CID 140840545) has the molecular formula C21H31BFNO4 and a molecular weight of 391.29 g/mol. Its IUPAC name is [3-fluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclobutyl] N-tert-butylcarbamate.
| Compound Name | [3-fluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclobutyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 140840545 |
| Molecular Formula | C21H31BFNO4 |
| Molecular Weight | 391.29 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | [3-fluoro-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclobutyl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OC1(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)CC(F)C1 |
| InChI | InChI=1S/C21H31BFNO4/c1-18(2,3)24-17(25)26-21(12-16(23)13-21)14-8-10-15(11-9-14)22-27-19(4,5)20(6,7)28-22/h8-11,16H,12-13H2,1-7H3,(H,24,25) |
| InChIKey | VNRBAENAFNRQAO-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.29 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|