C29H47BN2O4 — CID 167383686
[3-[4-methyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pentan-2-yl]-3-azabicyclo[3.1.0]hexan-6-yl]methyl N-tert-butylcarbamate (PubChem CID 167383686) has the molecular formula C29H47BN2O4 and a molecular weight of 498.52 g/mol. Its IUPAC name is [3-[4-methyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pentan-2-yl]-3-azabicyclo[3.1.0]hexan-6-yl]methyl N-tert-butylcarbamate.
| Compound Name | [3-[4-methyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pentan-2-yl]-3-azabicyclo[3.1.0]hexan-6-yl]methyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 167383686 |
| Molecular Formula | C29H47BN2O4 |
| Molecular Weight | 498.52 g/mol |
| Exact Mass | 498.36 |
| IUPAC Name | [3-[4-methyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pentan-2-yl]-3-azabicyclo[3.1.0]hexan-6-yl]methyl N-tert-butylcarbamate |
| SMILES | CC(C)CC(Cc1ccc(B2OC(C)(C)C(C)(C)O2)cc1)N1CC2C(COC(=O)NC(C)(C)C)C2C1 |
| InChI | InChI=1S/C29H47BN2O4/c1-19(2)14-22(32-16-23-24(17-32)25(23)18-34-26(33)31-27(3,4)5)15-20-10-12-21(13-11-20)30-35-28(6,7)29(8,9)36-30/h10-13,19,22-25H,14-18H2,1-9H3,(H,31,33) |
| InChIKey | AFNZPGXOCJLKNC-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.52 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|