C26H41BN2O4 — CID 167383485
[3-[(2R)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-yl]-3-azabicyclo[3.1.0]hexan-6-yl]methyl N-tert-butylcarbamate (PubChem CID 167383485) has the molecular formula C26H41BN2O4 and a molecular weight of 456.44 g/mol. Its IUPAC name is [3-[(2R)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-yl]-3-azabicyclo[3.1.0]hexan-6-yl]methyl N-tert-butylcarbamate.
| Compound Name | [3-[(2R)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-yl]-3-azabicyclo[3.1.0]hexan-6-yl]methyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 167383485 |
| Molecular Formula | C26H41BN2O4 |
| Molecular Weight | 456.44 g/mol |
| Exact Mass | 456.32 |
| IUPAC Name | [3-[(2R)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-yl]-3-azabicyclo[3.1.0]hexan-6-yl]methyl N-tert-butylcarbamate |
| SMILES | C[C@H](Cc1ccc(B2OC(C)(C)C(C)(C)O2)cc1)N1CC2C(COC(=O)NC(C)(C)C)C2C1 |
| InChI | InChI=1S/C26H41BN2O4/c1-17(29-14-20-21(15-29)22(20)16-31-23(30)28-24(2,3)4)13-18-9-11-19(12-10-18)27-32-25(5,6)26(7,8)33-27/h9-12,17,20-22H,13-16H2,1-8H3,(H,28,30)/t17-,20?,21?,22?/m1/s1 |
| InChIKey | XTQSNKLRJSBJMG-LAQKFSSHSA-N |
| XLogP | 3.62 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|