C29H42BNO4Si — CID 154134299
N-[2-(2-tert-butylsilyloxypropan-2-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-cyclopropylbenzamide (PubChem CID 154134299) has the molecular formula C29H42BNO4Si and a molecular weight of 507.56 g/mol. Its IUPAC name is N-[2-(2-tert-butylsilyloxypropan-2-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-cyclopropylbenzamide.
| Compound Name | N-[2-(2-tert-butylsilyloxypropan-2-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-cyclopropylbenzamide |
|---|---|
| PubChem CID | 154134299 |
| Molecular Formula | C29H42BNO4Si |
| Molecular Weight | 507.56 g/mol |
| Exact Mass | 507.30 |
| IUPAC Name | N-[2-(2-tert-butylsilyloxypropan-2-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-cyclopropylbenzamide |
| SMILES | CC(C)(C)[SiH2]OC(C)(C)c1c(NC(=O)c2ccc(C3CC3)cc2)cccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C29H42BNO4Si/c1-26(2,3)36-35-27(4,5)24-22(30-33-28(6,7)29(8,9)34-30)11-10-12-23(24)31-25(32)21-17-15-20(16-18-21)19-13-14-19/h10-12,15-19H,13-14,36H2,1-9H3,(H,31,32) |
| InChIKey | JTJYYMJNJDKTPE-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.56 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|