C33H48B2O7 — CID 66909894
bis[2-tert-butyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] carbonate (PubChem CID 66909894) has the molecular formula C33H48B2O7 and a molecular weight of 578.36 g/mol. Its IUPAC name is bis[2-tert-butyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] carbonate.
| Compound Name | bis[2-tert-butyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] carbonate |
|---|---|
| PubChem CID | 66909894 |
| Molecular Formula | C33H48B2O7 |
| Molecular Weight | 578.36 g/mol |
| Exact Mass | 578.36 |
| IUPAC Name | bis[2-tert-butyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] carbonate |
| SMILES | CC(C)(C)c1c(OC(=O)Oc2cccc(B3OC(C)(C)C(C)(C)O3)c2C(C)(C)C)cccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C33H48B2O7/c1-28(2,3)25-21(34-39-30(7,8)31(9,10)40-34)17-15-19-23(25)37-27(36)38-24-20-16-18-22(26(24)29(4,5)6)35-41-32(11,12)33(13,14)42-35/h15-20H,1-14H3 |
| InChIKey | DQYWDDQQDPEKKQ-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.36 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|