C14H16BF3O3 — CID 142478499
2,2,2-trifluoro-1-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone (PubChem CID 142478499) has the molecular formula C14H16BF3O3 and a molecular weight of 300.09 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone |
|---|---|
| PubChem CID | 142478499 |
| Molecular Formula | C14H16BF3O3 |
| Molecular Weight | 300.09 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 2,2,2-trifluoro-1-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone |
| SMILES | CC1(C)OB(c2ccccc2C(=O)C(F)(F)F)OC1(C)C |
| InChI | InChI=1S/C14H16BF3O3/c1-12(2)13(3,4)21-15(20-12)10-8-6-5-7-9(10)11(19)14(16,17)18/h5-8H,1-4H3 |
| InChIKey | SSXVFJRPXUMPFH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.09 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|